AA12414
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $18.00 | $13.00 | - + | |
1g | 98% | in stock | $26.00 | $18.00 | - + | |
5g | 98% | in stock | $56.00 | $40.00 | - + | |
25g | 98% | in stock | $278.00 | $195.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA12414 |
Chemical Name: | 4-(N-Butoxy)benzenesulfonyl chloride |
CAS Number: | 1138-56-3 |
Molecular Formula: | C10H13ClO3S |
Molecular Weight: | 248.7264 |
MDL Number: | MFCD00052344 |
SMILES: | CCCCOc1ccc(cc1)S(=O)(=O)Cl |
Complexity: | 263 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.5 |
4-Butoxybenzene-1-sulfonyl chloride, also known as butyl 4-sulfonylbenzoate, is a versatile intermediate in chemical synthesis widely used in pharmaceutical and agrochemical industries. This compound serves as a key building block for the introduction of the sulfonyl group (-SO2Cl) into organic molecules, allowing for the creation of diverse chemical structures with valuable properties.In chemical synthesis, 4-Butoxybenzene-1-sulfonyl chloride is commonly employed as a sulfonylating reagent for the functionalization of various substrates. It can react with nucleophiles such as amines, alcohols, and thiols, leading to the formation of sulfonylated products. This sulfonyl chloride is particularly useful in the preparation of sulfonamides, a class of compounds with important biological activities, including antimicrobial and anticancer properties.Furthermore, 4-Butoxybenzene-1-sulfonyl chloride can be utilized in the construction of complex organic molecules through sulfonyl group transfer reactions. By selectively modifying specific functional groups within a molecule, this compound enables chemists to tailor the properties of the final products for target applications. Its compatibility with a variety of reaction conditions and its ability to introduce the sulfonyl functionality make it a valuable tool in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals.