logo
Home  > 1-(4-(Trifluoromethyl)phenyl)pyrrolidine

AA12607

113845-68-4 | 1-(4-(Trifluoromethyl)phenyl)pyrrolidine

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $21.00 $15.00 -   +
1g 98% in stock $82.00 $58.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA12607
Chemical Name: 1-(4-(Trifluoromethyl)phenyl)pyrrolidine
CAS Number: 113845-68-4
Molecular Formula: C11H12F3N
Molecular Weight: 215.2149
MDL Number: MFCD16140176
SMILES: FC(c1ccc(cc1)N1CCCC1)(F)F

 

Upstream Synthesis Route 
  • Pyrrolidine, 1-[4-(trifluoromethyl)phenyl]- is a versatile compound widely used in organic synthesis for its unique reactivity and structural properties. This specific derivative of pyrrolidine, bearing a trifluoromethylphenyl group, plays a crucial role in various chemical transformations and reactions.In chemical synthesis, Pyrrolidine, 1-[4-(trifluoromethyl)phenyl]- is frequently employed as a chiral building block for the synthesis of pharmaceuticals, agrochemicals, and advanced materials. Due to its sterically demanding and electron-withdrawing trifluoromethylphenyl moiety, this compound can influence the stereochemistry and regioselectivity of reactions, making it a valuable tool in asymmetric synthesis.Moreover, the presence of the trifluoromethyl group in Pyrrolidine, 1-[4-(trifluoromethyl)phenyl]- imparts unique physicochemical properties to the molecule, such as altered lipophilicity and increased stability. These features make it particularly useful in the development of bioactive compounds and drug candidates with improved pharmacokinetic profiles.Overall, Pyrrolidine, 1-[4-(trifluoromethyl)phenyl]- stands out as a key reagent in the realm of chemical synthesis, offering synthetic chemists a powerful means to access structurally diverse and functionally rich molecules with enhanced properties for various applications.
FEATURED PRODUCTS