AE13988
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 98% | in stock | $39.00 | $28.00 | - + | |
100mg | 98% | in stock | $53.00 | $38.00 | - + | |
250mg | 98% | in stock | $107.00 | $75.00 | - + | |
1g | 98% | in stock | $419.00 | $294.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE13988 |
Chemical Name: | Tris(acetonitrile)pentamethylcyclopentadienylruthenium(I) trifluoromethanesulfonate |
CAS Number: | 113860-02-9 |
Molecular Formula: | C17H24F3N3O3RuS |
Molecular Weight: | 508.5209695999998 |
MDL Number: | MFCD07369036 |
SMILES: | FC(S(=O)(=O)[O-])(F)F.CC#[N][Ru+2]1234([N]#CC)([N]#CC)[C]5(=[C]3([C]2(=[C]1([C-]45C)C)C)C)C |
Tris(acetonitrile)pentamethylcyclopentadienylruthenium(I) trifluoromethanesulfonate is a versatile and highly efficient catalyst widely used in chemical synthesis processes. This specialized compound plays a vital role in various organic transformations, offering unique benefits in the field of synthetic chemistry.One key application of Tris(acetonitrile)pentamethylcyclopentadienylruthenium(I) trifluoromethanesulfonate is in promoting carbon-carbon and carbon-heteroatom bond formation reactions. Its catalytic properties enable the selective activation of specific chemical bonds, facilitating the synthesis of complex molecules with high efficiency and selectivity. This compound has been utilized in a range of transformations including cross-coupling reactions, oxidative coupling reactions, and C-H activation processes.Moreover, Tris(acetonitrile)pentamethylcyclopentadienylruthenium(I) trifluoromethanesulfonate is known for its ability to catalyze various organic transformations under mild reaction conditions. This feature not only enhances the overall efficiency of the synthesis process but also enables the development of new methodologies in organic chemistry. The use of this catalyst can lead to improved yields, reduced reaction times, and minimized waste generation in chemical reactions.In summary, the application of Tris(acetonitrile)pentamethylcyclopentadienylruthenium(I) trifluoromethanesulfonate in chemical synthesis offers a powerful tool for organic chemists to access novel chemical structures and functionalized molecules through efficient bond-forming processes.