AA13351
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $88.00 | $61.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA13351 |
Chemical Name: | 5-(4-Fluorophenyl)-4h-1,2,4-triazole-3-thiol |
CAS Number: | 114058-91-2 |
Molecular Formula: | C8H6FN3S |
Molecular Weight: | 195.2167 |
MDL Number: | MFCD02952174 |
SMILES: | Fc1ccc(cc1)c1[nH][nH]c(=S)n1 |
The compound 5-(4-Fluorophenyl)-4H-1,2,4-triazole-3-thiol, commonly referred to as $name$, plays a crucial role in chemical synthesis as a versatile building block. Its unique structure and properties make it an essential component in the creation of various valuable compounds and materials.$name$ is frequently utilized as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and materials with diverse applications. Its sulfur-containing thiol group enables selective functionalization reactions, allowing chemists to modify the molecule strategically to introduce specific functionalities.In organic synthesis, $name$ serves as a valuable precursor for the construction of complex molecules with biological or material significance. Its triazole ring provides opportunities for further derivatization, leading to the development of innovative compounds with desirable properties.Furthermore, the presence of the fluorophenyl group in $name$ enhances its reactivity and compatibility with a wide range of synthetic strategies. This feature makes it an attractive candidate for designing new molecules with tailored properties for various industrial applications.Overall, the application of 5-(4-Fluorophenyl)-4H-1,2,4-triazole-3-thiol in chemical synthesis offers a pathway to the creation of diverse and functional molecules, making it a valuable tool for researchers and chemists in the field.