AA13793
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $9.00 | $7.00 | - + | |
100g | 97% | in stock | $164.00 | $115.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA13793 |
Chemical Name: | 4,4'-Dichlorodiphenyl disulfide |
CAS Number: | 1142-19-4 |
Molecular Formula: | C12H8Cl2S2 |
Molecular Weight: | 287.2279 |
MDL Number: | MFCD00013642 |
SMILES: | Clc1ccc(cc1)SSc1ccc(cc1)Cl |
Complexity: | 175 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 5.7 |
4,4'-Dichlorodiphenyl disulfide is utilized as a versatile reagent in chemical synthesis, particularly in the field of organic chemistry. This compound serves as a key building block for the synthesis of various organic molecules and polymers. With its unique chemical structure, 4,4'-Dichlorodiphenyl disulfide functions as a valuable intermediate in the production of specialty chemicals, pharmaceuticals, and agrochemicals. Its ability to undergo substitution reactions and form complex compounds makes it an essential component in the toolbox of synthetic chemists. Additionally, this compound exhibits properties that make it suitable for use in the development of advanced materials, such as functional polymers and coatings. Its versatility and reactivity make 4,4'-Dichlorodiphenyl disulfide a crucial compound in the realm of chemical synthesis, enabling the creation of novel compounds with diverse applications.
Acta crystallographica. Section E, Structure reports online 20100701
The Journal of organic chemistry 20010629
Journal of medicinal chemistry 19960913