AA13806
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
2.5mg | 3 weeks | $418.00 | $292.00 | - + | ||
10mg | 3 weeks | $1,086.00 | $760.00 | - + | ||
25mg | 3 weeks | $2,043.00 | $1,430.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA13806 |
Chemical Name: | 3-Quinolinecarboxylic acid, 1-cyclopropyl-7-(3,4-dimethyl-1-piperazinyl)-6-fluoro-1,4-dihydro-8-methoxy-4-oxo- |
CAS Number: | 114213-69-3 |
Molecular Formula: | C20H24FN3O4 |
Molecular Weight: | 389.4207 |
MDL Number: | MFCD18252346 |
SMILES: | COc1c(N2CCN(C(C2)C)C)c(F)cc2c1n(cc(c2=O)C(=O)O)C1CC1 |
N-Methyl Gatifloxacin, a derivative of the fluoroquinolone antibiotic Gatifloxacin, plays a crucial role in chemical synthesis as a versatile building block. Its application in organic chemistry extends to the synthesis of various pharmaceutical compounds and novel molecules due to its unique structural properties and functional groups. N-Methyl Gatifloxacin serves as a valuable intermediate in the pharmaceutical industry, facilitating the creation of new drug candidates and enhancing the efficiency of synthetic routes. This compound's compatibility with diverse reaction conditions and its ability to undergo selective transformations make it a valuable asset in the realm of chemical synthesis.