logo
Home  > 5-Bromo-2-methyl-4-nitroaniline

AA13925

1142382-25-9 | 5-Bromo-2-methyl-4-nitroaniline

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $270.00 $189.00 -   +
1g 95% in stock $675.00 $472.00 -   +
5g 95% in stock $2,023.00 $1,416.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA13925
Chemical Name: 5-Bromo-2-methyl-4-nitroaniline
CAS Number: 1142382-25-9
Molecular Formula: C7H7BrN2O2
Molecular Weight: 231.0467
MDL Number: MFCD25459251
SMILES: [O-][N+](=O)c1cc(C)c(cc1Br)N

 

Upstream Synthesis Route
  • 5-Bromo-2-methyl-4-nitroaniline is a versatile compound commonly used in chemical synthesis for various applications. In organic chemistry, this compound serves as a key building block in the synthesis of diverse molecules due to its unique reactivity and functional groups. Its bromine, nitro, and aniline moieties allow for a wide range of reactions, making it valuable in the formation of complex organic compounds.In particular, 5-Bromo-2-methyl-4-nitroaniline is frequently utilized in the pharmaceutical industry for the production of drug intermediates and active pharmaceutical ingredients (APIs). Its presence in a molecule can impart desirable properties or specific functions crucial for the therapeutic activity of a drug. By incorporating this compound into the structure of pharmaceutical compounds, chemists can modulate the bioavailability, efficacy, or pharmacokinetics of the resulting drugs.Furthermore, this compound finds applications in material science for the synthesis of functional materials and organic dyes. Its chemical properties make it suitable for designing materials with specific electronic, optical, or magnetic properties. By incorporating 5-Bromo-2-methyl-4-nitroaniline into polymer matrices or molecular structures, researchers can tailor the material's characteristics for a wide range of technological applications, including sensors, organic light-emitting diodes (OLEDs), and nonlinear optical materials.
FEATURED PRODUCTS