AA14089
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $6.00 | $4.00 | - + | |
250mg | 98% | in stock | $8.00 | $5.00 | - + | |
1g | 98% | in stock | $9.00 | $6.00 | - + | |
5g | 98% | in stock | $32.00 | $22.00 | - + | |
25g | 98% | in stock | $139.00 | $97.00 | - + | |
500g | 98% | in stock | $2,313.00 | $1,619.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA14089 |
Chemical Name: | 3,8-Dihydroxy-6H-benzo[c]chromen-6-one |
CAS Number: | 1143-70-0 |
Molecular Formula: | C13H8O4 |
Molecular Weight: | 228.2002 |
MDL Number: | MFCD20275235 |
SMILES: | Oc1ccc2c(c1)oc(=O)c1c2ccc(c1)O |
Utilizing 3,8-Dihydroxy-6H-Dibenzo[b,d]Pyran-6-One in chemical synthesis offers a valuable tool for creating intricate molecular structures in the laboratory. This compound serves as a versatile building block with unique properties that enable its incorporation into various synthetic pathways. By leveraging the reactive functionalities present in 3,8-Dihydroxy-6H-Dibenzo[b,d]Pyran-6-One, chemists can efficiently introduce specific structural motifs and functional groups into target molecules, facilitating the development of novel compounds for research and industrial applications. Furthermore, the distinct chemical reactivity of this compound allows for strategic modifications and derivatizations, enabling the synthesis of diverse molecular scaffolds and potential pharmaceutical intermediates. As a key component in synthetic chemistry, 3,8-Dihydroxy-6H-Dibenzo[b,d]Pyran-6-One plays a crucial role in advancing the frontier of chemical innovation and molecular design.