logo
Home  > Ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-hydroxypropanoate

AA14468

114420-06-3 | Ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-hydroxypropanoate

Packsize Purity Availability Price Discounted Price    Quantity
50mg 95% 1 week $627.00 $439.00 -   +
100mg 95% 1 week $895.00 $627.00 -   +
250mg 95% 1 week $1,243.00 $870.00 -   +
500mg 95% 1 week $1,913.00 $1,339.00 -   +
1g 95% 1 week $2,428.00 $1,699.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA14468
Chemical Name: Ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-hydroxypropanoate
CAS Number: 114420-06-3
Molecular Formula: C10H16F2O5
Molecular Weight: 254.2278
MDL Number: MFCD08460241
SMILES: CCOC(=O)C(C(C1COC(O1)(C)C)O)(F)F

 

Upstream Synthesis Route 
  • The compound Ethyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-difluoro-3-hydroxypropanoate plays a crucial role in chemical synthesis due to its unique structural features and reactivity. This compound can serve as a valuable building block in the synthesis of various pharmaceuticals and agrochemicals. Its multifunctional groups allow for versatile transformations, such as selective oxidation, reduction, or functional group interconversion. Additionally, the presence of the difluoro and hydroxy groups can facilitate specific interactions with biological targets, enhancing the pharmacological properties of the final products. Its incorporation in synthesis pathways can lead to the efficient production of new drug candidates or bioactive compounds with enhanced efficacy.
FEATURED PRODUCTS