AA18833
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $160.00 | $112.00 | - + | |
5mg | 98% | in stock | $628.00 | $440.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA18833 |
Chemical Name: | Ganoderiol F |
CAS Number: | 114567-47-4 |
Molecular Formula: | C30H46O3 |
Molecular Weight: | 454.6844 |
MDL Number: | MFCD17214920 |
SMILES: | OCC(=CCC[C@H]([C@H]1CC[C@@]2([C@]1(C)CC=C1C2=CC[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C)CO |
Ganoderiol F, a naturally occurring triterpenoid compound found in Ganoderma lucidum, holds significant promise in chemical synthesis applications. With its unique molecular structure and diverse functional groups, Ganoderiol F serves as a valuable building block for the creation of novel organic compounds. In the realm of chemical synthesis, this compound is particularly prized for its ability to undergo diverse chemical transformations, making it a versatile starting material for the production of complex molecules. Researchers leverage the reactivity of Ganoderiol F to facilitate various synthetic strategies, such as functional group modifications, ring expansions, and stereoselective reactions. Additionally, the presence of multiple reactive sites within its structure enables chemists to tailor its properties for specific applications, further expanding its utility in the realm of synthetic chemistry. Ganoderiol F thus stands as a crucial component in the toolkit of synthetic chemists, offering a pathway to the development of innovative molecules and materials with potential applications in pharmaceuticals, materials science, and beyond.