logo
Home  > Ganoderiol F

AA18833

114567-47-4 | Ganoderiol F

Packsize Purity Availability Price Discounted Price    Quantity
1mg 98% in stock $160.00 $112.00 -   +
5mg 98% in stock $628.00 $440.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA18833
Chemical Name: Ganoderiol F
CAS Number: 114567-47-4
Molecular Formula: C30H46O3
Molecular Weight: 454.6844
MDL Number: MFCD17214920
SMILES: OCC(=CCC[C@H]([C@H]1CC[C@@]2([C@]1(C)CC=C1C2=CC[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C)CO

 

Upstream Synthesis Route
  • Ganoderiol F, a naturally occurring triterpenoid compound found in Ganoderma lucidum, holds significant promise in chemical synthesis applications. With its unique molecular structure and diverse functional groups, Ganoderiol F serves as a valuable building block for the creation of novel organic compounds. In the realm of chemical synthesis, this compound is particularly prized for its ability to undergo diverse chemical transformations, making it a versatile starting material for the production of complex molecules. Researchers leverage the reactivity of Ganoderiol F to facilitate various synthetic strategies, such as functional group modifications, ring expansions, and stereoselective reactions. Additionally, the presence of multiple reactive sites within its structure enables chemists to tailor its properties for specific applications, further expanding its utility in the realm of synthetic chemistry. Ganoderiol F thus stands as a crucial component in the toolkit of synthetic chemists, offering a pathway to the development of innovative molecules and materials with potential applications in pharmaceuticals, materials science, and beyond.
FEATURED PRODUCTS