logo
Home  > L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2-methyl-

BD65920

1145678-75-6 | L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2-methyl-

Packsize Purity Availability Price Discounted Price    Quantity
50mg 98% in stock $113.00 $79.00 -   +
100mg 98% in stock $184.00 $129.00 -   +
250mg 98% in stock $362.00 $253.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: BD65920
Chemical Name: L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2-methyl-
CAS Number: 1145678-75-6
Molecular Formula: C25H23NO5
Molecular Weight: 417.4538
SMILES: O=C(N[C@H](C(=O)O)Cc1ccc(cc1C)O)OCC1c2ccccc2-c2c1cccc2

 

Upstream Synthesis Route
  • N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2-methyl-L-tyrosine, commonly known as $name$, serves as a versatile building block in chemical synthesis. This compound plays a crucial role in peptide synthesis and drug development due to its unique chemical properties. By incorporating $name$ into synthetic pathways, chemists can efficiently introduce the specific functional groups and stereochemistry required for the production of complex organic molecules. Additionally, the presence of the fluorenyl protecting group in $name$ enhances the stability of the molecule during various chemical reactions, making it an essential tool in organic synthesis strategies.
FEATURED PRODUCTS