BD65920
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 98% | in stock | $113.00 | $79.00 | - + | |
100mg | 98% | in stock | $184.00 | $129.00 | - + | |
250mg | 98% | in stock | $362.00 | $253.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BD65920 |
Chemical Name: | L-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2-methyl- |
CAS Number: | 1145678-75-6 |
Molecular Formula: | C25H23NO5 |
Molecular Weight: | 417.4538 |
SMILES: | O=C(N[C@H](C(=O)O)Cc1ccc(cc1C)O)OCC1c2ccccc2-c2c1cccc2 |
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2-methyl-L-tyrosine, commonly known as $name$, serves as a versatile building block in chemical synthesis. This compound plays a crucial role in peptide synthesis and drug development due to its unique chemical properties. By incorporating $name$ into synthetic pathways, chemists can efficiently introduce the specific functional groups and stereochemistry required for the production of complex organic molecules. Additionally, the presence of the fluorenyl protecting group in $name$ enhances the stability of the molecule during various chemical reactions, making it an essential tool in organic synthesis strategies.