logo
Home  > Soyasaponin BA

AE17208

114590-20-4 | Soyasaponin BA

Packsize Purity Availability Price Discounted Price    Quantity
20mg in stock $394.00 $276.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE17208
Chemical Name: Soyasaponin BA
CAS Number: 114590-20-4
Molecular Formula: C48H78O19
Molecular Weight: 959.1215200000004
MDL Number: MFCD06656327
SMILES: OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O)C(=O)O)O[C@H]2CC[C@]3([C@H]([C@@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)C[C@H]2O)C)C)C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O

 

Upstream Synthesis Route
  • Soyasaponin Ba is a natural compound that serves a crucial role in chemical synthesis processes. As a versatile chemical agent, Soyasaponin Ba is widely utilized in organic chemistry to facilitate various transformations. Its unique structural properties make it a valuable tool for achieving complex chemical reactions with high efficiency and selectivity. In the field of chemical synthesis, Soyasaponin Ba is particularly valued for its ability to act as a catalyst, enabling the formation of new bonds and the synthesis of intricate molecular structures. Additionally, its compatibility with a range of reaction conditions makes it an indispensable component in the development of novel synthetic methodologies. Overall, Soyasaponin Ba plays a pivotal role in advancing the frontiers of chemical synthesis by enabling the efficient production of diverse organic compounds with important applications across industries.
FEATURED PRODUCTS