AA19236
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $16.00 | $11.00 | - + | |
5mg | 99% | in stock | $32.00 | $23.00 | - + | |
10mg | 99% | in stock | $43.00 | $30.00 | - + | |
50mg | 99% | in stock | $121.00 | $85.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19236 |
Chemical Name: | Bms-708163 |
CAS Number: | 1146699-66-2 |
Molecular Formula: | C20H17ClF4N4O4S |
Molecular Weight: | 520.885 |
MDL Number: | MFCD13195458 |
SMILES: | NC(=O)[C@H](N(S(=O)(=O)c1ccc(cc1)Cl)Cc1ccc(cc1F)c1nocn1)CCC(F)(F)F |
Complexity: | 792 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 11 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 9 |
XLogP3: | 4 |
Avagacestat is a potent chemical compound utilized in the field of chemical synthesis for its role as a γ-secretase inhibitor. This inhibitor function is pivotal in the manipulation of protein processing, particularly the cleavage of amyloid precursor protein. By effectively inhibiting γ-secretase, Avagacestat can modulate the generation of amyloid beta peptides, making it a crucial tool in the study of neurodegenerative diseases such as Alzheimer's. Additionally, Avagacestat's application extends to drug development, where its ability to influence protein cleavage pathways plays a significant role in designing novel therapeutic agents targeting various diseases characterized by aberrant protein processing.
Toxicological sciences : an official journal of the Society of Toxicology 20180601
Journal of medicinal chemistry 20130711
Archives of neurology 20121101
Journal of pharmaceutical sciences 20120901
Journal of medicinal chemistry 20120412
The Journal of pharmacology and experimental therapeutics 20111201
Journal of medicinal chemistry 20111124
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences 20100901
Journal of medicinal chemistry 20091022