AE28498
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $13.00 | $9.00 | - + | |
250mg | 97% | in stock | $17.00 | $12.00 | - + | |
1g | 97% | in stock | $31.00 | $22.00 | - + | |
5g | 97% | in stock | $99.00 | $69.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE28498 |
Chemical Name: | Spiro[2H-indole-2,3'-[3H]naphth[2,1-b][1,4]oxazine], 1,3-dihydro-1,3,3-triMethyl-6'-(4-Morpholinyl)- |
CAS Number: | 114747-48-7 |
Molecular Formula: | C26H27N3O2 |
Molecular Weight: | 413.5115 |
MDL Number: | MFCD00329492 |
SMILES: | CN1c2ccccc2C(C21C=Nc1c(O2)cc(c2c1cccc2)N1CCOCC1)(C)C |
1,3-Dihydro-1,3,3-trimethyl-6′-(4-morpholinyl)spiro[2H-indole-2,3′-[3H]naphth[2,1-b][1,4]oxazine] can be utilized in chemical synthesis as a versatile building block for the generation of novel heterocyclic compounds. Specifically, its unique structural properties make it an ideal precursor in the synthesis of complex molecules with potential biological activity. The spirocyclic nature of this compound provides a scaffold for further functionalization, allowing chemists to introduce various substituents and functional groups to modulate the properties of the final product. Additionally, the presence of the morpholinyl group offers the possibility of interactions with biological targets, making it a promising candidate for drug discovery and development efforts. Overall, the incorporation of 1,3-Dihydro-1,3,3-trimethyl-6′-(4-morpholinyl)spiro[2H-indole-2,3′-[3H]naphth[2,1-b][1,4]oxazine] in chemical synthesis opens up opportunities for the creation of diverse chemical libraries for potential applications in medicinal chemistry and material science.