logo
Home  > 2,6-Difluoro-4-(methylsulfonyl)aniline

AA19458

1147557-74-1 | 2,6-Difluoro-4-(methylsulfonyl)aniline

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $265.00 $185.00 -   +
250mg 95% in stock $278.00 $194.00 -   +
1g 95% in stock $605.00 $423.00 -   +
5g 95% in stock $1,783.00 $1,248.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA19458
Chemical Name: 2,6-Difluoro-4-(methylsulfonyl)aniline
CAS Number: 1147557-74-1
Molecular Formula: C7H7F2NO2S
Molecular Weight: 207.1978
MDL Number: MFCD24642337
SMILES: Nc1c(F)cc(cc1F)S(=O)(=O)C

 

Upstream Synthesis Route
  • 2,6-Difluoro-4-(methylsulfonyl)aniline is a versatile chemical compound that finds widespread application in chemical synthesis processes. As a key intermediate in organic chemistry, this compound plays a crucial role in the development of various pharmaceuticals, agrochemicals, and materials.In chemical synthesis, 2,6-Difluoro-4-(methylsulfonyl)aniline serves as a building block for the creation of complex molecules with specific properties. Its unique structure, characterized by the presence of fluorine and sulfonyl groups, imparts desirable characteristics to the final products. The fluorine atoms can influence the bioavailability and metabolic stability of pharmaceuticals, making them important for drug design and development.Additionally, the methylsulfonyl group in 2,6-Difluoro-4-(methylsulfonyl)aniline can act as a directing group in transition metal-catalyzed coupling reactions, facilitating selective bond formation at specific positions within a molecule. This enables chemists to streamline synthetic pathways and achieve higher yields of desired products.Overall, the strategic use of 2,6-Difluoro-4-(methylsulfonyl)aniline in chemical synthesis enables researchers to access a diverse array of compounds that have applications in pharmaceuticals, agrochemicals, and materials science. Its versatility and reactivity make it a valuable tool for the development of innovative and functional molecules with tailored properties.
FEATURED PRODUCTS