AA19456
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $8.00 | $5.00 | - + | |
250mg | 95% | in stock | $8.00 | $6.00 | - + | |
1g | 95% | in stock | $14.00 | $10.00 | - + | |
5g | 95% | in stock | $44.00 | $31.00 | - + | |
10g | 95% | in stock | $86.00 | $61.00 | - + | |
25g | 95% | in stock | $214.00 | $150.00 | - + | |
100g | 95% | in stock | $855.00 | $599.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19456 |
Chemical Name: | tert-Butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate |
CAS Number: | 1147557-97-8 |
Molecular Formula: | C11H19NO3 |
Molecular Weight: | 213.2735 |
MDL Number: | MFCD15071431 |
SMILES: | OC1CC2(C1)CN(C2)C(=O)OC(C)(C)C |
Complexity: | 268 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.9 |
The tert-Butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate is commonly used in chemical synthesis as a versatile building block due to its unique structure and reactivity. Its spirocyclic nature makes it an important component in the creation of complex organic compounds and pharmaceutical intermediates.This compound can be utilized in the synthesis of various heterocyclic compounds and complex organic molecules through different reactions such as esterification, hydroxylation, and spirocyclization. Its tert-butyl group provides steric hindrance, which can influence the stereochemistry of reactions and enhance selectivity in certain transformations.In pharmaceutical synthesis, tert-Butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate can serve as a key starting material for the production of spirocyclic scaffolds found in biologically active compounds. Its hydroxy and carboxylic acid functionalities offer points for further derivatization, enabling the introduction of additional chemical groups to fine-tune the properties of the final molecule.Overall, the application of tert-Butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate in chemical synthesis lies in its ability to facilitate the construction of diverse and structurally complex molecules, particularly in the fields of organic chemistry and pharmaceutical development.