AA19578
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $39.00 | $28.00 | - + | |
250mg | 95% | in stock | $79.00 | $56.00 | - + | |
1g | 95% | in stock | $300.00 | $210.00 | - + | |
5g | 95% | in stock | $1,289.00 | $903.00 | - + | |
10g | 95% | in stock | $2,218.00 | $1,552.00 | - + | |
25g | 95% | in stock | $4,435.00 | $3,104.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19578 |
Chemical Name: | (1R,3R,5R)-2-Boc-2-azabicyclo[3.1.0]hexane-3-carboxylic acid |
CAS Number: | 1148048-39-8 |
Molecular Formula: | C11H17NO4 |
Molecular Weight: | 227.257 |
MDL Number: | MFCD16621713 |
SMILES: | O=C(N1[C@@H]2C[C@@H]2C[C@@H]1C(=O)O)OC(C)(C)C |
Complexity: | 333 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.3 |
The compound (1R,3R,5R)-2-(tert-Butoxycarbonyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid is a valuable building block in chemical synthesis. Its unique structure and stereochemistry make it suitable for use in the creation of complex molecules and pharmaceutical intermediates. In particular, this compound can serve as a chiral starting material for the synthesis of biologically active compounds, such as pharmaceuticals, agrochemicals, and natural products. Its rigid bicyclic framework and functional groups provide versatility in forming bonds with other molecules, enabling the production of diverse and enantioenriched products.