AA19601
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $10.00 | $7.00 | - + | |
250mg | 98% | in stock | $19.00 | $14.00 | - + | |
1g | 98% | in stock | $55.00 | $39.00 | - + | |
5g | 98% | in stock | $256.00 | $180.00 | - + | |
10g | 98% | in stock | $420.00 | $294.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19601 |
Chemical Name: | Chloro[2-(dicyclohexylphosphino)-3,6-dimethoxy-2',4',6'-triisopropyl-1,1'-biphenyl][2-(2-aminoethyl)phenyl]palladium(ii) |
CAS Number: | 1148148-01-9 |
Molecular Formula: | C43H63ClNO2PPd |
Molecular Weight: | 798.8125810000001 |
MDL Number: | MFCD12545956 |
SMILES: | COc1ccc(c(c1c1c(cc(cc1C(C)C)C(C)C)C(C)C)[P]([Pd+2]1([Cl-])[NH2]CCC2=CC=CC=[C-]12)(C1CCCCC1)C1CCCCC1)OC |
Chloro(2-(dicyclohexylphosphino)-3,6-dimethoxy-2',4',6'-triisopropyl-1,1'-biphenyl)(2-(2-aminoethyl)phenyl)palladium(II) is a versatile catalyst commonly used in chemical synthesis processes. It is a complex containing palladium that facilitates a variety of organic transformations through its unique ligand environment.This catalyst has found wide application in cross-coupling reactions, particularly in the formation of carbon-carbon and carbon-heteroatom bonds. Its high reactivity and selectivity make it a valuable tool for the construction of complex organic molecules. Additionally, it has shown efficacy in the functionalization of aromatic compounds, allylic and benzylic substrates, and amines.Moreover, Chloro(2-(dicyclohexylphosphino)-3,6-dimethoxy-2',4',6'-triisopropyl-1,1'-biphenyl)(2-(2-aminoethyl)phenyl)palladium(II) has been employed in cascade reactions and sequential processes, enabling the rapid and efficient synthesis of intricate structures. Its compatibility with a wide range of functional groups further enhances its utility in organic synthesis.Overall, this catalyst plays a crucial role in modern synthetic methodologies, contributing to the advancement of chemical science and the development of innovative materials and pharmaceuticals.