AA19720
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $9.00 | $6.00 | - + | |
1g | 95% | in stock | $15.00 | $10.00 | - + | |
5g | 95% | in stock | $42.00 | $29.00 | - + | |
10g | 95% | in stock | $82.00 | $58.00 | - + | |
25g | 95% | in stock | $136.00 | $95.00 | - + | |
100g | 95% | in stock | $446.00 | $312.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19720 |
Chemical Name: | 1,2-O-Isopropylidene-a-l-xylofuranose |
CAS Number: | 114861-22-2 |
Molecular Formula: | C8H14O5 |
Molecular Weight: | 190.19375999999997 |
MDL Number: | MFCD00010529 |
SMILES: | OC[C@@H]1O[C@@H]2[C@H]([C@@H]1O)OC(O2)(C)C |
Complexity: | 205 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | -0.4 |
The compound ($name$) exhibits significant utility in chemical synthesis as a versatile building block due to its unique structure. Its hydroxymethyl group enables facile functional group transformations, making it a valuable intermediate in the synthesis of various complex organic molecules. Specifically, the hydroxymethyl moiety can serve as a precursor for the introduction of diverse functional groups through selective chemical reactions, facilitating the creation of structurally intricate and pharmaceutically relevant compounds. This compound's strategic placement of functional groups and stereochemistry render it a valuable tool for synthetic chemists seeking to efficiently construct molecular frameworks with precision and control.