AA19747
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $28.00 | $19.00 | - + | |
5g | 97% | in stock | $85.00 | $59.00 | - + | |
10g | 97% | in stock | $106.00 | $74.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19747 |
Chemical Name: | D-2,4-Dichlorophenylalanine |
CAS Number: | 114872-98-9 |
Molecular Formula: | C9H9Cl2NO2 |
Molecular Weight: | 234.0793 |
MDL Number: | MFCD01860873 |
SMILES: | OC(=O)[C@@H](Cc1ccc(cc1Cl)Cl)N |
2,4-Dichloro-D-phenylalanine is a versatile compound that finds wide application in chemical synthesis processes. This compound serves as a valuable building block in the creation of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structural properties make it ideal for use in the synthesis of complex molecules where stereochemistry is crucial. 2,4-Dichloro-D-phenylalanine is commonly employed in the development of new drugs, particularly in the creation of chiral drugs where the specific arrangement of atoms is critical for their efficacy. In addition, this compound is utilized in the synthesis of novel materials with tailored properties for various industrial applications. Its role in chemical synthesis highlights its importance as a key component in the creation of diverse molecular structures with specific functionalities.