AA19743
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $10.00 | $7.00 | - + | |
1g | 95% | in stock | $19.00 | $13.00 | - + | |
5g | 95% | in stock | $64.00 | $45.00 | - + | |
10g | 95% | in stock | $79.00 | $56.00 | - + | |
25g | 95% | in stock | $105.00 | $74.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19743 |
Chemical Name: | Boc-L-2-chlorophenylalanine |
CAS Number: | 114873-02-8 |
Molecular Formula: | C14H18ClNO4 |
Molecular Weight: | 299.75 |
MDL Number: | MFCD00672514 |
SMILES: | O=C(OC(C)(C)C)N[C@H](C(=O)O)Cc1ccccc1Cl |
Complexity: | 354 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 3.1 |
The chemical compound (S)-2-((tert-Butoxycarbonyl)amino)-3-(2-chlorophenyl)propanoic acid, also known as $name$, plays a crucial role in chemical synthesis as a key intermediate in the formation of various pharmaceuticals and specialized organic molecules. This compound is renowned for its ability to act as a chiral building block, enabling the creation of asymmetric structures with specific stereochemistry. By incorporating (S)-2-((tert-Butoxycarbonyl)amino)-3-(2-chlorophenyl)propanoic acid into synthetic pathways, chemists can efficiently access complex molecules with high levels of enantiomeric purity. Its versatility and compatibility with a wide range of reactions make it an indispensable tool for modern organic synthesis strategies.