AA19742
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $22.00 | $15.00 | - + | |
1g | 95% | in stock | $25.00 | $18.00 | - + | |
5g | 95% | in stock | $35.00 | $25.00 | - + | |
10g | 95% | in stock | $55.00 | $39.00 | - + | |
25g | 95% | in stock | $122.00 | $86.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19742 |
Chemical Name: | Boc-L-3-chlorophenylalanine |
CAS Number: | 114873-03-9 |
Molecular Formula: | C14H18ClNO4 |
Molecular Weight: | 299.75 |
MDL Number: | MFCD00672515 |
SMILES: | O=C(OC(C)(C)C)N[C@H](C(=O)O)Cc1cccc(c1)Cl |
Complexity: | 354 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 3.1 |
Boc-Phe(3-Cl)-OH, also known as tert-butoxycarbonyl-L-phenylalanine(3-chloro)-ol, is a key intermediate in chemical synthesis processes. This compound is commonly used as a protected amino acid building block in peptide synthesis. By incorporating Boc-Phe(3-Cl)-OH into the peptide chain, chemists can selectively protect the amino group, allowing for precise control over the sequence of amino acids during peptide assembly. This protection strategy helps to prevent unwanted side reactions and ensures the successful synthesis of complex peptides with high purity and yield. Additionally, Boc-Phe(3-Cl)-OH can be employed in the synthesis of pharmaceuticals, agrochemicals, and other bioactive compounds where the precise arrangement of amino acids is critical for the desired biological activity. Its versatile applications make Boc-Phe(3-Cl)-OH a valuable tool in organic chemistry research and drug discovery efforts.