AA19739
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $41.00 | $29.00 | - + | |
5g | 97% | in stock | $89.00 | $62.00 | - + | |
25g | 97% | in stock | $249.00 | $175.00 | - + | |
100g | 97% | in stock | $758.00 | $531.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19739 |
Chemical Name: | Boc-3-methyl-L-phenylalanine |
CAS Number: | 114873-06-2 |
Molecular Formula: | C15H21NO4 |
Molecular Weight: | 279.3315 |
MDL Number: | MFCD01862944 |
SMILES: | O=C(OC(C)(C)C)N[C@H](C(=O)O)Cc1cccc(c1)C |
Complexity: | 348 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 2.5 |
Boc-Phe(3-Me)-OH, also known as tert-butoxycarbonyl-L-phenylalanine(3-methyl)-l-phenylalanine, is a crucial compound in chemical synthesis. This versatile building block is commonly used in peptide synthesis, a process of creating peptides by chemically linking amino acids together.In peptide synthesis, Boc-Phe(3-Me)-OH serves as an essential amino acid derivative that aids in the formation of peptide bonds. By incorporating this compound into the peptide chain, chemists can control the sequence and structure of the resulting peptide. Additionally, the Boc (tert-butoxycarbonyl) protecting group attached to the phenylalanine amino acid offers stability during the synthesis process, allowing for precise manipulation and modification of the peptide sequence.Overall, Boc-Phe(3-Me)-OH plays a critical role in the synthesis of complex peptides for various applications, including drug development, biological research, and biotechnological advancements. Its compatibility with standard peptide synthesis protocols and its ability to facilitate the creation of unique peptide sequences make it a valuable tool for chemists and researchers in the field of organic chemistry.