AA19735
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $15.00 | $10.00 | - + | |
5g | 95% | in stock | $42.00 | $30.00 | - + | |
10g | 95% | in stock | $68.00 | $47.00 | - + | |
25g | 95% | in stock | $145.00 | $101.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19735 |
Chemical Name: | Boc-3-fluoro-d-phenylalanine |
CAS Number: | 114873-11-9 |
Molecular Formula: | C14H18FNO4 |
Molecular Weight: | 283.29542319999996 |
MDL Number: | MFCD00672523 |
SMILES: | O=C(OC(C)(C)C)N[C@@H](C(=O)O)Cc1cccc(c1)F |
Complexity: | 354 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 2.6 |
British journal of haematology 20090301