AA19793
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $6.00 | $4.00 | - + | |
10g | 98% | in stock | $7.00 | $5.00 | - + | |
25g | 95% | in stock | $8.00 | $6.00 | - + | |
100g | 98% | in stock | $20.00 | $14.00 | - + | |
500g | 98% | in stock | $90.00 | $63.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19793 |
Chemical Name: | Z-Val-OH |
CAS Number: | 1149-26-4 |
Molecular Formula: | C13H17NO4 |
Molecular Weight: | 251.2784 |
MDL Number: | MFCD00008922 |
SMILES: | CC([C@@H](C(=O)O)NC(=O)OCc1ccccc1)C |
Complexity: | 285 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 1.4 |
The Journal of organic chemistry 20020322