AA19858
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19858 |
Chemical Name: | Uridine, 5-methyl-2-O-methyl- (9CI) |
CAS Number: | 114952-97-5 |
Molecular Formula: | C11H16N2O6 |
Molecular Weight: | 272.2545 |
MDL Number: | MFCD03788700 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cc(C)c(=O)nc1OC |
Uridine, 5-methyl-2-O-methyl- (9CI) is a valuable compound in chemical synthesis, particularly in the field of nucleotide and nucleoside chemistry. This specific derivative of uridine is commonly used as a building block or precursor in the synthesis of various nucleoside analogs and pharmaceutical intermediates.In organic synthesis, Uridine, 5-methyl-2-O-methyl- (9CI) serves as a key starting material in the creation of modified nucleosides that exhibit specialized properties or functionalities. By incorporating this compound into the reaction scheme, chemists can customize the structure of nucleosides to potentially enhance their biological activity, stability, or interaction with target molecules.Furthermore, the specific chemical modifications present in Uridine, 5-methyl-2-O-methyl- (9CI) allow for precise control over the regioselectivity and stereochemistry of the resulting products. This control is essential in designing nucleoside analogs with desired pharmacological profiles or in studying the structure-activity relationships of nucleoside-based compounds.Overall, Uridine, 5-methyl-2-O-methyl- (9CI) plays a crucial role in advancing the field of chemical synthesis by enabling the creation of novel nucleoside derivatives with potential applications in drug discovery, molecular biology, and medicinal chemistry.