AE16272
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $42.00 | $30.00 | - + | |
250mg | 98% | in stock | $78.00 | $54.00 | - + | |
1g | 98% | in stock | $207.00 | $145.00 | - + | |
5g | 98% | in stock | $722.00 | $505.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE16272 |
Chemical Name: | oxyphenisatine di(acetate) |
CAS Number: | 115-33-3 |
Molecular Formula: | C24H19NO5 |
Molecular Weight: | 401.4114 |
MDL Number: | MFCD00022793 |
SMILES: | CC(=O)Oc1ccc(cc1)C1(c2ccc(cc2)OC(=O)C)C(=O)Nc2c1cccc2 |
The (2-Oxoindoline-3,3-diyl)bis(4,1-phenylene) diacetate is a versatile compound that finds significant application in chemical synthesis. This compound serves as a valuable building block in the creation of complex organic molecules and materials due to its unique structural and reactive properties.In chemical synthesis, (2-Oxoindoline-3,3-diyl)bis(4,1-phenylene) diacetate is commonly used as a key intermediate for the generation of functionalized organic compounds. Its bifunctional nature, with two acetyl groups attached to the central indoline ring, allows for selective and controlled transformations through various chemical reactions.One of the primary applications of this compound is as a starting material in the synthesis of asymmetric molecules, such as chiral ligands, pharmaceutical intermediates, and advanced materials with controlled stereochemistry. The presence of the indoline moiety imparts unique electronic and steric properties, making it a valuable precursor for the construction of diverse molecular architectures.Additionally, (2-Oxoindoline-3,3-diyl)bis(4,1-phenylene) diacetate serves as a versatile coupling agent in cross-coupling reactions, allowing for the formation of complex carbon-carbon and carbon-heteroatom bonds. This enables the efficient construction of diverse molecular scaffolds with tailored functionalities and properties.Overall, the strategic incorporation of (2-Oxoindoline-3,3-diyl)bis(4,1-phenylene) diacetate in chemical synthesis provides chemists with a powerful tool for the design and preparation of structurally diverse, functionalized organic compounds with broad applications in the fields of organic chemistry, materials science, and pharmaceutical research.