AA19975
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $57.00 | $40.00 | - + | |
5g | 97% | in stock | $153.00 | $107.00 | - + | |
25g | 97% | in stock | $494.00 | $346.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA19975 |
Chemical Name: | Silicic acid (H4SiO4), tetrakis(2-ethylhexyl) ester |
CAS Number: | 115-82-2 |
Molecular Formula: | C32H68O4Si |
Molecular Weight: | 544.9654 |
MDL Number: | MFCD00015263 |
SMILES: | CCCCC(CO[Si](OCC(CCCC)CC)(OCC(CCCC)CC)OCC(CCCC)CC)CC |
Tetrakis(2-ethylhexyl) orthosilicate, also known as TEOS, is a versatile chemical compound commonly used in chemical synthesis processes. Its application in the field of chemistry is significant due to its ability to act as a precursor in the synthesis of various silicon-based materials. TEOS serves as a crucial building block in the production of silicon dioxide, commonly known as silica, which finds extensive use in the fabrication of glass, ceramics, and electronic materials. Additionally, TEOS can be employed as a reagent in the production of organosilicon compounds, which have widespread applications in industries such as pharmaceuticals, coatings, and adhesives. Its unique structure and reactivity make Tetrakis(2-ethylhexyl) orthosilicate a valuable component in the chemical synthesis toolbox, allowing for the creation of a diverse range of materials with tailored properties to meet specific industrial needs.