AA20038
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $23.00 | $16.00 | - + | |
5g | 95% | in stock | $105.00 | $74.00 | - + | |
10g | 95% | in stock | $177.00 | $124.00 | - + | |
25g | 95% | in stock | $318.00 | $223.00 | - + | |
100g | 95% | in stock | $1,178.00 | $824.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20038 |
Chemical Name: | 2,3-Dihydro-1-benzofuran-5-sulfonyl chloride |
CAS Number: | 115010-11-2 |
Molecular Formula: | C8H7ClO3S |
Molecular Weight: | 218.6574 |
MDL Number: | MFCD02677703 |
SMILES: | ClS(=O)(=O)c1ccc2c(c1)CCO2 |
Complexity: | 282 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.9 |
2,3-Dihydro-1-benzofuran-5-sulfonoylchloride is a versatile compound widely used in chemical synthesis. This compound is particularly valuable in the realm of organic synthesis, where it serves as a key building block for the creation of various pharmaceuticals, agrochemicals, and materials. Through its unique structure and reactivity, 2,3-Dihydro-1-benzofuran-5-sulfonoylchloride can participate in a wide range of chemical reactions, such as nucleophilic substitution, Friedel-Crafts acylation, and transition metal-catalyzed cross-coupling reactions. These synthetic pathways enable the incorporation of the sulfonoyl group into target molecules, allowing for the fine-tuning of their physicochemical properties and biological activities.In medicinal chemistry, 2,3-Dihydro-1-benzofuran-5-sulfonoylchloride is utilized for the synthesis of biologically active molecules, including potential drug candidates and probes for biological studies. Its sulfonoyl functionality can enhance the solubility, stability, and bioavailability of the resulting compounds, making it a valuable tool in drug discovery and development.Furthermore, in agrochemical research, 2,3-Dihydro-1-benzofuran-5-sulfonoylchloride can be employed to design new pesticides, herbicides, and fungicides with improved efficacy and environmental safety profiles. By introducing the sulfonoyl moiety into agrochemical structures, researchers can modulate their performance characteristics and target specificity, leading to more sustainable agricultural practices.Overall, the application of 2,3-Dihydro-1-benzofuran-5-sulfonoylchloride in chemical synthesis underscores its importance as a versatile reagent for the construction of complex molecular architectures with tailored functions in diverse fields of science and industry.