AA20062
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $86.00 | $60.00 | - + | |
250mg | 95% | in stock | $136.00 | $96.00 | - + | |
1g | 95% | in stock | $367.00 | $257.00 | - + | |
5g | 95% | in stock | $1,403.00 | $982.00 | - + | |
10g | 95% | in stock | $2,338.00 | $1,637.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20062 |
Chemical Name: | 6-(Methoxycarbonyl)indole-2-boronic acid |
CAS Number: | 1150114-47-8 |
Molecular Formula: | C10H10BNO4 |
Molecular Weight: | 219.0017 |
MDL Number: | MFCD11855843 |
SMILES: | COC(=O)c1ccc2c(c1)[nH]c(c2)B(O)O |
Complexity: | 274 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
The (6-(Methoxycarbonyl)-1H-indol-2-yl)boronic acid is a versatile chemical compound widely utilized in chemical synthesis due to its valuable properties. This compound serves as a key building block in the creation of various organic molecules and pharmaceuticals. With its boronic acid functionality, it acts as a crucial reagent in Suzuki-Miyaura cross-coupling reactions, allowing for the efficient formation of carbon-carbon bonds. Additionally, its indole core provides a structural motif commonly found in bioactive compounds, making it a valuable component in drug discovery and development. In synthesis, this compound enables the introduction of the (methoxycarbonyl) group, facilitating the preparation of complex molecules with precision and efficiency.