AA20054
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $355.00 | $248.00 | - + | |
1g | 97% | in stock | $867.00 | $607.00 | - + | |
5g | 97% | in stock | $2,499.00 | $1,749.00 | - + | |
10g | 97% | in stock | $3,743.00 | $2,620.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20054 |
Chemical Name: | 4-(2-Morpholinoethyl)phenylboronic acid |
CAS Number: | 1150114-55-8 |
Molecular Formula: | C12H18BNO3 |
Molecular Weight: | 235.0872 |
MDL Number: | MFCD11855848 |
SMILES: | OB(c1ccc(cc1)CCN1CCOCC1)O |
Complexity: | 214 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
The (4-(2-Morpholinoethyl)phenyl)boronic acid is a versatile compound widely used in chemical synthesis as a key building block in the development of various organic molecules. In particular, this molecule has found significant application as a crucial reagent in the Suzuki-Miyaura coupling reaction, a pivotal organic transformation that enables the formation of carbon-carbon bonds. This boronic acid derivative serves as a valuable partner in coupling reactions with aryl halides or pseudohalides, leading to the creation of complex organic structures with high efficiency and selectivity. Additionally, the (4-(2-Morpholinoethyl)phenyl)boronic acid has been employed in the synthesis of pharmaceuticals, agrochemicals, and materials science, highlighting its remarkable utility in the realm of modern organic synthesis. By facilitating the construction of intricate molecular architectures, this compound plays a pivotal role in accelerating the development of new functional materials and bioactive compounds with diverse applications across various scientific disciplines.