AA20164
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $161.00 | $113.00 | - + | |
1g | 98% | in stock | $386.00 | $270.00 | - + | |
5g | 98% | in stock | $1,317.00 | $922.00 | - + | |
10g | 98% | in stock | $2,002.00 | $1,402.00 | - + | |
25g | 98% | in stock | $3,743.00 | $2,620.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20164 |
Chemical Name: | 5-(Ethoxycarbonyl)thiophene-2-boronic acid, pinacol ester |
CAS Number: | 1150271-60-5 |
Molecular Formula: | C13H19BO4S |
Molecular Weight: | 282.1636 |
MDL Number: | MFCD11855979 |
SMILES: | CCOC(=O)c1ccc(s1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 343 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 4 |
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate is a versatile chemical compound commonly used in chemical synthesis procedures. This compound serves as a valuable building block in the creation of various organic molecules due to its unique structure and reactivity.When incorporated into chemical reactions, Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate acts as a key precursor for the introduction of functional groups such as thiophene and boron-containing moieties. These functional groups play significant roles in drug discovery, material science, and agrochemical development.In organic synthesis, this compound can be utilized in cross-coupling reactions, palladium-catalyzed coupling reactions, and Suzuki-Miyaura coupling reactions to create complex organic structures efficiently. Its presence enables the formation of carbon-carbon bonds, which are essential for the construction of diverse chemical compounds.Overall, Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate facilitates the preparation of intricate molecules with specific functionalities, making it a valuable tool in the realm of chemical synthesis.