logo
Home  > Chemistry  > Organic Building Blocks  > Trifluoromethyls  > 2-Fluoro-4-(trifluoromethyl)benzoic acid

AA20209

115029-24-8 | 2-Fluoro-4-(trifluoromethyl)benzoic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $16.00 $11.00 -   +
1g 95% in stock $18.00 $12.00 -   +
5g 95% in stock $39.00 $27.00 -   +
10g 95% in stock $49.00 $34.00 -   +
25g 95% in stock $63.00 $45.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA20209
Chemical Name: 2-Fluoro-4-(trifluoromethyl)benzoic acid
CAS Number: 115029-24-8
Molecular Formula: C8H4F4O2
Molecular Weight: 208.1098
MDL Number: MFCD00010322
SMILES: OC(=O)c1ccc(cc1F)C(F)(F)F

 

Computed Properties
Complexity: 226  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 14  
Hydrogen Bond Acceptor Count: 6  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 1  
XLogP3: 3.4  

 

 

Upstream Synthesis Route
  • 2-Fluoro-4-(trifluoromethyl)benzoic acid is a versatile compound widely employed in chemical synthesis for its unique properties and reactivity. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and materials due to its ability to participate in a diverse range of chemical reactions. The presence of both the fluoro and trifluoromethyl groups offers significant opportunities for modifying the structure and properties of organic molecules in a controlled manner. Additionally, the benzoic acid moiety provides a convenient handle for further functionalization, making 2-Fluoro-4-(trifluoromethyl)benzoic acid a valuable tool in the synthesis of complex organic compounds with tailored properties. Its role in chemical synthesis extends to the development of novel materials with advanced functionalities, making it a valuable asset in the realm of modern organic chemistry.
FEATURED PRODUCTS