AA20281
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $89.00 | $62.00 | - + | |
1g | 96% | in stock | $192.00 | $135.00 | - + | |
5g | 96% | in stock | $579.00 | $405.00 | - + | |
25g | 96% | in stock | $2,111.00 | $1,478.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20281 |
Chemical Name: | 4-(4-Cbz-piperazinyl)phenylboronic acid, pinacol ester |
CAS Number: | 1150561-68-4 |
Molecular Formula: | C24H31BN2O4 |
Molecular Weight: | 422.3249 |
MDL Number: | MFCD12026103 |
SMILES: | O=C(N1CCN(CC1)c1ccc(cc1)B1OC(C(O1)(C)C)(C)C)OCc1ccccc1 |
Complexity: | 591 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 5 |
Benzyl 4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperazine-1-carboxylate is a versatile compound extensively utilized in chemical synthesis. This compound serves as a crucial building block for the creation of various organic molecules due to its unique structural properties. Its application in chemical synthesis primarily involves its ability to act as a key intermediate in the formation of complex organic compounds with diverse functionalities and applications. By incorporating this compound into chemical reactions, researchers can access a wide range of structurally diverse molecules for pharmaceutical, agrochemical, and material science research. The presence of the boron atom in the molecule further enhances its reactivity and compatibility with various synthetic methodologies, making it a valuable tool in the hands of synthetic chemists.