AA20272
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $9.00 | $6.00 | - + | |
1g | 98% | in stock | $28.00 | $19.00 | - + | |
2.5g | 98% | in stock | $43.00 | $31.00 | - + | |
5g | 98% | in stock | $59.00 | $42.00 | - + | |
10g | 98% | in stock | $95.00 | $67.00 | - + | |
25g | 98% | in stock | $226.00 | $159.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20272 |
Chemical Name: | 2-(Methoxycarbonyl)ethylboronic acid, pinacol ester |
CAS Number: | 1150561-77-5 |
Molecular Formula: | C10H19BO4 |
Molecular Weight: | 214.06645999999995 |
MDL Number: | MFCD10700159 |
SMILES: | COC(=O)CCB1OC(C(O1)(C)C)(C)C |
Complexity: | 234 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 4 |
Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate is a versatile compound widely used in chemical synthesis due to its unique reactivity and functional group compatibility. It serves as a valuable building block in organic chemistry, particularly in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals.This compound is commonly employed as a key intermediate in Suzuki-Miyaura cross-coupling reactions, a powerful tool in modern organic synthesis for forming carbon-carbon bonds. By utilizing Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate as a boronic acid ester, chemists can efficiently introduce various functional groups onto aromatic and aliphatic substrates under mild reaction conditions.Furthermore, the compatibility of this compound with a variety of reaction partners makes it a valuable tool for the construction of complex molecular structures. Its stability and ease of handling make it a preferred choice for synthetic chemists looking to streamline their processes and achieve high yields of desired products.In summary, Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate is an essential building block in chemical synthesis, offering a range of applications in the efficient formation of carbon-carbon bonds and the synthesis of diverse organic molecules.