AA20264
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | in stock | $14.00 | $10.00 | - + | |
250mg | 95% | in stock | $20.00 | $14.00 | - + | |
1g | 95% | in stock | $23.00 | $17.00 | - + | |
5g | 95% | in stock | $47.00 | $33.00 | - + | |
10g | 95% | in stock | $85.00 | $60.00 | - + | |
25g | 95% | in stock | $131.00 | $92.00 | - + | |
100g | 95% | in stock | $403.00 | $283.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20264 |
Chemical Name: | Ethyl 6-chloroimidazo[1,2-b]pyridazine-3-carboxylate |
CAS Number: | 1150566-27-0 |
Molecular Formula: | C9H8ClN3O2 |
Molecular Weight: | 225.6317 |
MDL Number: | MFCD11975600 |
SMILES: | CCOC(=O)c1cnc2n1nc(Cl)cc2 |
Complexity: | 252 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.8 |
Ethyl 6-chloroimidazo[1,2-b]pyridazine-3-carboxylate is a versatile compound widely used in chemical synthesis as a key building block. Its distinctive structure combines the imidazo[1,2-b]pyridazine core with a chloro group and an ethyl ester functional group. This unique composition enables the compound to participate in various important reactions, such as nucleophilic substitution, condensation, and cycloaddition, leading to the synthesis of diverse pharmaceuticals, agrochemicals, and materials of interest. In addition, the presence of the carboxylate moiety offers the potential for further derivatization and modification, expanding its utility in the creation of novel compounds with tailored properties for specific applications in drug discovery, material science, and chemical research.