AA20353
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $46.00 | $32.00 | - + | |
1g | 95% | in stock | $120.00 | $84.00 | - + | |
5g | 95% | in stock | $381.00 | $267.00 | - + | |
25g | 95% | in stock | $1,550.00 | $1,085.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20353 |
Chemical Name: | 2-(Dimethoxymethyl)pyridine-5-boronic acid pinacol ester |
CAS Number: | 1150632-93-1 |
Molecular Formula: | C14H22BNO4 |
Molecular Weight: | 279.1398 |
MDL Number: | MFCD16038216 |
SMILES: | COC(c1ccc(cn1)B1OC(C(O1)(C)C)(C)C)OC |
2-(Dimethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, known for its strong chemical properties, is a versatile compound widely utilized in chemical synthesis applications. This unique compound serves as a key building block in various organic reactions, particularly in the formation of complex molecular structures. It plays a crucial role in the creation of novel pharmaceuticals, agrochemicals, and materials due to its ability to participate in diverse synthetic pathways. Additionally, 2-(Dimethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is valued for its compatibility with a range of reagents and reaction conditions, making it an essential component in advanced organic synthesis strategies. Its presence in the chemical synthesis toolkit underscores its significance in enabling the development of innovative compounds with potential applications across various industries.