logo
Home  > Chemistry  > Organic Building Blocks  > Amides  > 2-BOC-aminophenylboronic acid

AA21400

115377-94-1 | 2-BOC-aminophenylboronic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $37.00 $26.00 -   +
1g 98% in stock $51.00 $36.00 -   +
5g 98% in stock $201.00 $141.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA21400
Chemical Name: 2-BOC-aminophenylboronic acid
CAS Number: 115377-94-1
Molecular Formula: C11H16BNO4
Molecular Weight: 237.06
MDL Number: MFCD02179450
SMILES: O=C(OC(C)(C)C)Nc1ccccc1B(O)O

 

Computed Properties
Complexity: 265  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 17  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 3  
Rotatable Bond Count: 4  

 

 

Upstream Synthesis Route
  • (2-((tert-Butoxycarbonyl)amino)phenyl)boronic acid is a versatile compound widely used in chemical synthesis as a key building block for various organic reactions. Its unique structure allows for selective functionalization and cross-coupling reactions in the synthesis of complex organic molecules. This compound serves as a crucial intermediate in the formation of biologically active compounds, pharmaceuticals, and advanced materials. Its application in Suzuki-Miyaura coupling reactions enables the formation of carbon-carbon bonds, essential for constructing diverse organic frameworks. Additionally, (2-((tert-Butoxycarbonyl)amino)phenyl)boronic acid is utilized in the preparation of boron-containing polymers and coordination complexes, further demonstrating its significance in modern synthetic chemistry. Its compatibility with a wide range of functional groups makes it a valuable tool for chemists in achieving precise and efficient transformations during organic synthesis processes.
FEATURED PRODUCTS