logo
Home  > Benzamide, 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxy-

AA20486

1154-59-2 | Benzamide, 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxy-

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $19.00 $13.00 -   +
5g 95% in stock $47.00 $33.00 -   +
25g 95% in stock $175.00 $123.00 -   +
100g 95% in stock $551.00 $386.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA20486
Chemical Name: Benzamide, 3,5-dichloro-N-(3,4-dichlorophenyl)-2-hydroxy-
CAS Number: 1154-59-2
Molecular Formula: C13H7Cl4NO2
Molecular Weight: 351.0122
MDL Number: MFCD00041745
SMILES: Clc1cc(Cl)c(c(c1)C(=O)Nc1ccc(c(c1)Cl)Cl)O

 

Upstream Synthesis Route 
  • The compound 3,5-Dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide plays a crucial role in chemical synthesis as a key building block for the development of pharmaceuticals, agrochemicals, and materials science. Its highly specific chemical structure allows for versatile functional group transformations, making it a valuable intermediate in the creation of diverse complex molecules. This compound is particularly useful in the synthesis of bioactive compounds due to its ability to introduce multiple halogen functionalities into a target molecule. Additionally, its hydroxyl and amide groups offer opportunities for further derivatization, enabling the fine-tuning of molecular properties for specific applications. The strategic incorporation of 3,5-Dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide in chemical synthesis pathways facilitates the efficient construction of novel compounds with tailored functionalities and enhanced biological activities.
FEATURED PRODUCTS