AA20657
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $18.00 | $12.00 | - + | |
25g | 95% | in stock | $20.00 | $14.00 | - + | |
100g | 95% | in stock | $51.00 | $36.00 | - + | |
500g | 95% | in stock | $130.00 | $91.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20657 |
Chemical Name: | N-Cbz-L-glutamic acid |
CAS Number: | 1155-62-0 |
Molecular Formula: | C13H15NO6 |
Molecular Weight: | 281.2613 |
MDL Number: | MFCD00002801 |
SMILES: | O=C(N[C@H](C(=O)O)CCC(=O)O)OCc1ccccc1 |
Complexity: | 351 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 8 |
XLogP3: | 0.9 |
Chemical communications (Cambridge, England) 20041021
Archives of pharmacal research 20040201
The Journal of organic chemistry 20031114