AA20856
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $15.00 | $10.00 | - + | |
5g | 95% | in stock | $46.00 | $32.00 | - + | |
25g | 95% | in stock | $142.00 | $100.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA20856 |
Chemical Name: | Bis(4-nitrophenyl) sulfone |
CAS Number: | 1156-50-9 |
Molecular Formula: | C12H8N2O6S |
Molecular Weight: | 308.2667 |
MDL Number: | MFCD00010447 |
SMILES: | O=S(=O)(c1ccc(cc1)[N+](=O)[O-])c1ccc(cc1)[N+](=O)[O-] |
NSC Number: | 20609 |
Complexity: | 447 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.5 |
Journal of medicinal chemistry 20060824
Antimicrobial agents and chemotherapy 19970201