logo
Home  > (E)-1-(2-Nitrovinyl)-3-(trifluoromethyl)benzene

AA21453

115665-96-8 | (E)-1-(2-Nitrovinyl)-3-(trifluoromethyl)benzene

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $42.00 $29.00 -   +
1g 97% in stock $58.00 $41.00 -   +
5g 97% in stock $227.00 $159.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA21453
Chemical Name: (E)-1-(2-Nitrovinyl)-3-(trifluoromethyl)benzene
CAS Number: 115665-96-8
Molecular Formula: C9H6F3NO2
Molecular Weight: 217.1446
MDL Number: MFCD00176733
SMILES: [O-][N+](=O)/C=C/c1cccc(c1)C(F)(F)F

 

Upstream Synthesis Route 
  • The compound (E)-1-(2-Nitrovinyl)-3-(trifluoromethyl)benzene plays a crucial role in chemical synthesis as a versatile building block. It is commonly utilized in organic chemistry for the synthesis of various valuable molecules due to its unique structural features. Specifically, this compound serves as a key intermediate in the preparation of complex organic compounds and heterocyclic structures. By acting as a precursor in a range of synthetic reactions, it enables chemists to efficiently access diverse chemical structures with specific functionalities. Additionally, the presence of the nitrovinyl and trifluoromethyl groups imparts desirable properties to the resulting molecules, making them valuable in the development of new materials, pharmaceuticals, and agrochemicals.
FEATURED PRODUCTS