logo
Home  > 5-BRomo-1-(3-methoxypropyl)-1H-benzo[d]imidazol-2-amine

AV18587

1156930-01-6 | 5-BRomo-1-(3-methoxypropyl)-1H-benzo[d]imidazol-2-amine

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AV18587
Chemical Name: 5-BRomo-1-(3-methoxypropyl)-1H-benzo[d]imidazol-2-amine
CAS Number: 1156930-01-6
Molecular Formula: C11H14BrN3O
Molecular Weight: 284.1524
MDL Number: MFCD12111892
SMILES: COCCCn1c(N)nc2c1ccc(c2)Br

 

Computed Properties
Complexity: 229  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 16  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 4  
XLogP3: 2.3  

 

 

Upstream Synthesis Route
  • 5-Bromo-1-(3-methoxypropyl)-1H-benzo[d]imidazol-2-amine is a versatile compound widely used in chemical synthesis. Its primary application lies in the field of medicinal chemistry, where it serves as a key building block for the synthesis of various biologically active molecules. This compound's unique structure and functional groups make it an essential intermediate in the development of pharmaceuticals and agrochemicals. Specifically, 5-Bromo-1-(3-methoxypropyl)-1H-benzo[d]imidazol-2-amine is employed in the creation of novel drug candidates through the modification of its chemical properties, leading to diverse pharmacological profiles. Additionally, this compound can be utilized in the synthesis of specialized materials, dyes, and other organic compounds with specific functionalities, further highlighting its significance in chemical research and development.
FEATURED PRODUCTS