AA21506
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $105.00 | $74.00 | - + | |
5g | 98% | in stock | $297.00 | $208.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA21506 |
Chemical Name: | Ethyl 3-chloro-5-nitrobenzoate |
CAS Number: | 1156940-16-7 |
Molecular Formula: | C9H8ClNO4 |
Molecular Weight: | 229.6171 |
MDL Number: | MFCD12172957 |
SMILES: | CCOC(=O)c1cc(Cl)cc(c1)[N+](=O)[O-] |
Complexity: | 253 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | 3 |
Ethyl 3-chloro-5-nitrobenzoate is a versatile compound widely used in chemical synthesis for the preparation of various organic compounds. This compound serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. It is commonly employed as a building block in the synthesis of more complex molecules due to its ability to undergo a variety of chemical reactions, such as nucleophilic substitution and aromatic substitution. Ethyl 3-chloro-5-nitrobenzoate plays a crucial role in the development of new materials and compounds with diverse applications in industries such as pharmaceuticals, agrochemicals, and materials science.