AA21777
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $16.00 | $12.00 | - + | |
1g | 98% | in stock | $45.00 | $32.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA21777 |
Chemical Name: | Methyl 7-bromo-1h-indole-2-carboxylate |
CAS Number: | 1158503-82-2 |
Molecular Formula: | C10H8BrNO2 |
Molecular Weight: | 254.08 |
MDL Number: | MFCD11111832 |
SMILES: | COC(=O)c1cc2c([nH]1)c(Br)ccc2 |
Complexity: | 234 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.1 |
Methyl 7-bromo-1H-indole-2-carboxylate is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. It plays a crucial role as a key building block in the preparation of various biologically active molecules, pharmaceuticals, and agrochemicals.This compound acts as a valuable intermediate in the synthesis of indole-based compounds, which are significant in medicinal chemistry and material science. Its functional groups enable it to undergo various transformations, such as nucleophilic substitutions, palladium-catalyzed cross-coupling reactions, and cycloadditions, allowing for the efficient construction of complex molecular structures.In addition, Methyl 7-bromo-1H-indole-2-carboxylate serves as a crucial precursor for the synthesis of indole derivatives with diverse biological activities, including anticancer, antimicrobial, and anti-inflammatory properties. Its strategic incorporation into molecule design facilitates the modulation of biological targets and the enhancement of pharmacokinetic properties in drug discovery efforts.Overall, the application of Methyl 7-bromo-1H-indole-2-carboxylate in chemical synthesis enables the expedient access to valuable compounds with potential therapeutic benefits and paves the way for innovation in the field of organic chemistry and drug development.