AA21849
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 96% | in stock | $187.00 | $131.00 | - + | |
250mg | 96% | in stock | $323.00 | $226.00 | - + | |
1g | 96% | in stock | $768.00 | $537.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA21849 |
Chemical Name: | Sodium 2-(3,3-bis(4-(dimethylamino)phenyl)ureido)acetate |
CAS Number: | 115871-19-7 |
Molecular Formula: | C19H23N4NaO3 |
Molecular Weight: | 378.4007 |
MDL Number: | MFCD23135311 |
SMILES: | CN(c1ccc(cc1)N(c1ccc(cc1)N(C)C)C(=O)NCC(=O)[O-])C.[Na+] |
Complexity: | 446 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
The application of Sodium 2-(3,3-bis(4-(dimethylamino)phenyl)ureido)acetate in chemical synthesis is instrumental in various organic transformations, particularly in the field of medicinal chemistry and pharmaceuticals. This compound serves as a versatile reagent in the synthesis of complex molecules due to its unique structural properties. Sodium 2-(3,3-bis(4-(dimethylamino)phenyl)ureido)acetate is commonly utilized as a key intermediate in the preparation of novel urea derivatives and N-substituted carboxamides. Its ability to participate in diverse chemical reactions, such as amidation, acylation, and condensation, makes it a valuable building block for the construction of molecular libraries with potential biological activity. Furthermore, the presence of the dimethylamino groups enhances the solubility and reactivity of the compound, facilitating its use in various synthetic pathways for the production of biologically active compounds with tailored properties.