logo
Home  > tert-Butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate

AA21832

1158750-91-4 | tert-Butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $45.00 $32.00 -   +
250mg 97% in stock $71.00 $50.00 -   +
1g 97% in stock $199.00 $140.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA21832
Chemical Name: tert-Butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate
CAS Number: 1158750-91-4
Molecular Formula: C13H22N2O3
Molecular Weight: 254.3254
MDL Number: MFCD00005794
SMILES: O=C1NCC2(C1)CCCN(C2)C(=O)OC(C)(C)C

 

Upstream Synthesis Route
  • The chemical compound, 1,1-Dimethylethyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate, plays a crucial role in chemical synthesis due to its unique structural properties. This compound is commonly utilized as a key intermediate in the synthesis of various pharmaceuticals and bioactive molecules. Its spirocyclic structure provides a versatile platform for the development of new compounds with potential biological activities.In chemical synthesis, 1,1-Dimethylethyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate serves as a valuable building block for the construction of complex organic molecules with spirocyclic motifs. By incorporating this compound into synthetic pathways, chemists can access a diverse array of spirocyclic compounds that exhibit enhanced stability and unique pharmacological properties.Moreover, the presence of the 3-oxo group in 1,1-Dimethylethyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate enables further functionalization through various chemical reactions, allowing for the introduction of additional substituents or modifications to tailor the compound for specific applications. Its structural features make it a valuable tool for the creation of novel drug candidates and biologically active compounds in medicinal chemistry research. Additionally, the spirocyclic nature of this compound can influence the conformational flexibility and overall molecular shape of the synthesized molecules, potentially leading to improved interactions with biological targets.Overall, the application of 1,1-Dimethylethyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate in chemical synthesis offers a strategic approach to accessing structurally diverse compounds with potential pharmaceutical relevance, making it a valuable asset in the toolbox of synthetic chemists and drug discovery scientists.
FEATURED PRODUCTS