AA21922
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $7.00 | $5.00 | - + | |
5g | 98% | in stock | $10.00 | $7.00 | - + | |
10g | 98% | in stock | $18.00 | $13.00 | - + | |
25g | 95% | in stock | $29.00 | $21.00 | - + | |
500g | 95% | in stock | $553.00 | $388.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA21922 |
Chemical Name: | Tos-Arg-OH |
CAS Number: | 1159-15-5 |
Molecular Formula: | C13H20N4O4S |
Molecular Weight: | 328.3873 |
MDL Number: | MFCD08273565 |
SMILES: | NC(=N)NCCC[C@@H](C(=O)O)NS(=O)(=O)c1ccc(cc1)C |
Complexity: | 489 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 8 |
International journal of molecular sciences 20100101