AA22240
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $19.00 | $13.00 | - + | |
5g | 95% | in stock | $70.00 | $49.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA22240 |
Chemical Name: | benzyl 3-aminopyrrolidine-1-carboxylate, HCl |
CAS Number: | 1159822-27-1 |
Molecular Formula: | C12H17ClN2O2 |
Molecular Weight: | 256.7286 |
MDL Number: | MFCD09955427 |
SMILES: | NC1CCN(C1)C(=O)OCc1ccccc1.Cl |
Complexity: | 239 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
Undefined Atom Stereocenter Count: | 1 |
Benzyl 3-aminopyrrolidine-1-carboxylate hydrochloride is a versatile chemical compound widely used in chemical synthesis. It serves as a key building block in the creation of various organic molecules due to its unique structure and reactivity. In chemical synthesis, this compound is commonly employed as a precursor for the preparation of pharmaceutical intermediates, agrochemicals, and other specialty chemicals. Its functional groups allow for easy modification and manipulation, making it an essential tool for organic chemists seeking to fabricate complex molecules efficiently. Additionally, Benzyl 3-aminopyrrolidine-1-carboxylate hydrochloride exhibits excellent compatibility with a wide range of reaction conditions, enhancing its utility in diverse synthetic pathways.