logo
Home  > 3-(4-Amino-phenylamino)-piperidine-1-carboxylic acid tert-butyl ester

AA22368

1159976-34-7 | 3-(4-Amino-phenylamino)-piperidine-1-carboxylic acid tert-butyl ester

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $96.00 $68.00 -   +
250mg 95% in stock $172.00 $120.00 -   +
500mg 95% in stock $281.00 $197.00 -   +
1g 95% in stock $474.00 $332.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA22368
Chemical Name: 3-(4-Amino-phenylamino)-piperidine-1-carboxylic acid tert-butyl ester
CAS Number: 1159976-34-7
Molecular Formula: C16H25N3O2
Molecular Weight: 291.3886
MDL Number: MFCD12026439
SMILES: Nc1ccc(cc1)NC1CCCN(C1)C(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The compound 1,1-Dimethylethyl 3-[(4-aminophenyl)amino]-1-piperidinecarboxylate is a versatile chemical reagent widely used in the field of chemical synthesis. It plays a crucial role in various organic reactions due to its unique structure and properties. This compound is particularly valuable in the formation of complex organic molecules and pharmaceutical intermediates. Additionally, its combination of a piperidine ring and an aminophenyl group offers opportunities for diverse functional group transformations, making it an essential tool for synthetic chemists. Its application in coupling reactions, cyclization processes, and heterocyclic synthesis showcases its significance in modern organic chemistry.
FEATURED PRODUCTS